Compound Q&A

How is 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6) typically synthesized?

Answer

9-(4-Bromophenyl)-10-phenylanthracene
9-(4-Bromophenyl)-10-phenylanthracene is typically synthesized via a multistep process involving bromination of anthracene followed by coupling reactions. The synthesis usually involves the use of catalysts like palladium or copper complexes, achieving good yields. The reaction conditions include the use of suitable solvents and temperature controls to ensure the desired product formation.

About

English Name 9-(4-Bromophenyl)-10-phenylanthracene
Molecular Formula C26H17Br
Molecular Weight 409.3260000000001 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=C(C=C5)Br
InChIKey LDFCHUHQZQRSHF-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6)?

9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6)?

9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6) is used in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6)?

When handling 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6), it is essential to use perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...