Compound Q&A

What are the physical and chemical properties of 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6)?

Answer

9-(4-Bromophenyl)-10-phenylanthracene
9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6) is a crystalline solid with a molecular weight of approximately 440.16 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and chloroform. The compound is relatively stable under normal conditions but can undergo photodegradation. It exhibits strong electronic transitions in the UV-Vis region, indicating its potential use in optoelectronic applications.

About

English Name 9-(4-Bromophenyl)-10-phenylanthracene
Molecular Formula C26H17Br
Molecular Weight 409.3260000000001 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=C(C=C5)Br
InChIKey LDFCHUHQZQRSHF-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6) typically synthesized?

9-(4-Bromophenyl)-10-phenylanthracene is typically synthesized via a multistep process involving bro...

Compound Q&A

What industries use 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6)?

9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6) is used in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6)?

When handling 9-(4-Bromophenyl)-10-phenylanthracene (CAS: 625854-02-6), it is essential to use perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...