Compound Q&A

How should 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) be stored?

Answer

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole
4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) should be stored in a cool, dry place away from direct sunlight and heat sources to maintain its stability. It is recommended to store it in a tightly sealed container to prevent moisture and degradation. The storage temperature should be kept below 25°C (77°F) to ensure optimal chemical properties.

About

English Name 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole
Molecular Formula C13H16N2
Molecular Weight 200.28 g/mol
SMILES C[C@H](c1c[nH]cn1)c2cccc(C)c2C
InChIKey CUHVIMMYOGQXCV-NSHDSACASA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What is 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6)?

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) is a chemical compound with a m...

Compound Q&A

What are the main uses of 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6)?

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) is primarily used in pharmaceut...

Compound Q&A

Is 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) safe?

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) is generally considered safe wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...