Compound Q&A

What is 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6)?

Answer

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole
4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) is a chemical compound with a molecular structure that includes an imidazole ring and a 2,3-dimethylphenyl substituent. This compound is known for its unique chemical properties, such as its ability to form stable complexes with metal ions and its use in various applications.

About

English Name 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole
Molecular Formula C13H16N2
Molecular Weight 200.28 g/mol
SMILES C[C@H](c1c[nH]cn1)c2cccc(C)c2C
InChIKey CUHVIMMYOGQXCV-NSHDSACASA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What are the main uses of 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6)?

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) is primarily used in pharmaceut...

Compound Q&A

Is 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) safe?

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) is generally considered safe wh...

Compound Q&A

How should 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) be stored?

4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole (CAS: 113775-47-6) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...