Compound Q&A

How should Ambrisentan Impurity 8 (CAS: 178306-52-0) be stored?

Answer

Ambrisentan Impurity 8
Ambrisentan Impurity 8 should be stored in a cool, dry place, away from direct sunlight and moisture. It is recommended to store it in a tightly sealed container to prevent degradation. The exact storage temperature and conditions may vary depending on the specific properties of the impurity, so it is advisable to refer to the material safety data sheet (MSDS) for detailed storage instructions.

About

English Name Ambrisentan Impurity 8
Molecular Formula C16H16O4
Molecular Weight 272.3 g/mol
SMILES COC(C1=CC=CC=C1)(C2=CC=CC=C2)C(C(=O)O)O
InChIKey RQJWOLFMWKZKCJ-CQSZACIVSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What is Ambrisentan Impurity 8 (CAS: 178306-52-0)?

Ambrisentan Impurity 8 is a byproduct of the synthesis of Ambrisentan, a phosphodiesterase type 5 in...

Compound Q&A

What are the main uses of Ambrisentan Impurity 8 (CAS: 178306-52-0)?

Ambrisentan Impurity 8 is primarily used for quality control and impurity profiling in the pharmaceu...

Compound Q&A

Is Ambrisentan Impurity 8 (CAS: 178306-52-0) safe?

Ambrisentan Impurity 8 is generally considered safe when handled under proper laboratory conditions....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...