Compound Q&A

What are the main uses of Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5)?

Answer

Difluoro(fluorosulfonyl)acetic acid
Difluoro(fluorosulfonyl)acetic acid is primarily used in pharmaceutical development as a precursor for the synthesis of organic compounds, in research for the study of organic chemistry, and in industrial processes for the production of other chemicals. It can also be employed in the synthesis of certain drugs and in the production of materials with specific properties.

About

CAS No 1717-59-5
English Name Difluoro(fluorosulfonyl)acetic acid
Molecular Formula C2HF3O4S
Molecular Weight 178.09 g/mol
SMILES C(=O)(C(F)(F)S(=O)(=O)F)O
InChIKey VYDQUABHDFWIIX-UHFFFAOYSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What is Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5)?

Difluoro(fluorosulfonyl)acetic acid is a chemical compound with the molecular formula C4F6O4S. It is...

Compound Q&A

Is Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5) safe?

Difluoro(fluorosulfonyl)acetic acid is generally safe when handled with appropriate precautions. How...

Compound Q&A

How should Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5) be stored?

Difluoro(fluorosulfonyl)acetic acid should be stored in a cool, dry place to maintain its stability....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...