Compound Q&A

What is Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5)?

Answer

Difluoro(fluorosulfonyl)acetic acid
Difluoro(fluorosulfonyl)acetic acid is a chemical compound with the molecular formula C4F6O4S. It is a colorless to white solid with a strong pungent odor. This acid has a high boiling point and a low melting point. It is used in various applications such as pharmaceuticals, research, and industrial processes due to its unique chemical properties.

About

CAS No 1717-59-5
English Name Difluoro(fluorosulfonyl)acetic acid
Molecular Formula C2HF3O4S
Molecular Weight 178.09 g/mol
SMILES C(=O)(C(F)(F)S(=O)(=O)F)O
InChIKey VYDQUABHDFWIIX-UHFFFAOYSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What are the main uses of Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5)?

Difluoro(fluorosulfonyl)acetic acid is primarily used in pharmaceutical development as a precursor f...

Compound Q&A

Is Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5) safe?

Difluoro(fluorosulfonyl)acetic acid is generally safe when handled with appropriate precautions. How...

Compound Q&A

How should Difluoro(fluorosulfonyl)acetic acid (CAS: 1717-59-5) be stored?

Difluoro(fluorosulfonyl)acetic acid should be stored in a cool, dry place to maintain its stability....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...