Compound Q&A

What industries use 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5)?

Answer

1-Nitro-4-(trifluoromethoxy)benzene
1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) is used in various industries, particularly in pharmaceuticals and electronics. It serves as a key intermediate in the synthesis of drugs and is also utilized in the production of electronic materials due to its unique chemical and physical properties. Additionally, it is employed in the development of sensors and semiconductor materials.

About

CAS No 713-65-5
English Name 1-Nitro-4-(trifluoromethoxy)benzene
Molecular Formula C7H4F3NO3
Molecular Weight 207.11 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])OC(F)(F)F
InChIKey UBEIKVUMDBCCRW-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5)?

1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) typically synthesized?

1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) is typically synthesized via a nitration process...

Compound Q&A

What precautions should be taken when handling 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5)?

When handling 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...