Compound Q&A

How is 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) typically synthesized?

Answer

1-Nitro-4-(trifluoromethoxy)benzene
1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) is typically synthesized via a nitration process of 4-(trifluoromethoxy)benzene using a mixture of nitric acid and sulfuric acid. The reaction is carried out under fuming nitric acid conditions to ensure high selectivity and yield. Commonly, the use of a phase transfer catalyst is employed to improve the reaction rate and purity of the product.

About

CAS No 713-65-5
English Name 1-Nitro-4-(trifluoromethoxy)benzene
Molecular Formula C7H4F3NO3
Molecular Weight 207.11 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])OC(F)(F)F
InChIKey UBEIKVUMDBCCRW-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5)?

1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5)?

1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5) is used in various industries, particularly in p...

Compound Q&A

What precautions should be taken when handling 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5)?

When handling 1-Nitro-4-(trifluoromethoxy)benzene (CAS: 713-65-5), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...