Compound Q&A

What industries use 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9)?

Answer

2,6-Diisopropylphenyl isocyanate
2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds applications in the polymer industry for the production of special plastics and in the sensor industry for developing new sensors.

About

CAS No 28178-42-9
English Name 2,6-Diisopropylphenyl isocyanate
Molecular Formula C13H17NO
Molecular Weight 203.28 g/mol
SMILES CC(C)C1=C(C(=CC=C1)C(C)C)N=C=O
InChIKey FEUFNKALUGDEMQ-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9)?

2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) is a colorless to light yellow liquid with a mole...

Compound Q&A

How is 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) typically synthesized?

2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) can be synthesized through the reaction of 2,6-di...

Compound Q&A

What precautions should be taken when handling 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...