Compound Q&A

How is 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) typically synthesized?

Answer

2,6-Diisopropylphenyl isocyanate
2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) can be synthesized through the reaction of 2,6-diisopropylphenol with phosgene or carbon dioxide in the presence of a suitable catalyst. This process provides high selectivity and yield, though it requires careful handling due to the toxic nature of phosgene.

About

CAS No 28178-42-9
English Name 2,6-Diisopropylphenyl isocyanate
Molecular Formula C13H17NO
Molecular Weight 203.28 g/mol
SMILES CC(C)C1=C(C(=CC=C1)C(C)C)N=C=O
InChIKey FEUFNKALUGDEMQ-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9)?

2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) is a colorless to light yellow liquid with a mole...

Compound Q&A

What industries use 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9)?

2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 2,6-Diisopropylphenyl isocyanate (CAS: 28178-42-9)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...