Compound Q&A

What industries use 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9)?

Answer

1-Fluoro-2-methyl-4-nitrobenzene
1-Fluoro-2-methyl-4-nitrobenzene finds applications in the pharmaceutical industry, where it is used as an intermediate in the synthesis of certain drugs. It is also utilized in the production of dyes, pigments, and other chemical products. Additionally, it plays a role in the development of materials for sensors and semiconductors.

About

CAS No 455-88-9
English Name 1-Fluoro-2-methyl-4-nitrobenzene
Molecular Formula C7H6FNO2
Molecular Weight 155.13 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey XUCYJGMIICONES-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9)?

1-Fluoro-2-methyl-4-nitrobenzene is a crystalline solid with a molecular weight of approximately 184...

Compound Q&A

How is 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9) typically synthesized?

1-Fluoro-2-methyl-4-nitrobenzene is commonly synthesized via the nitration of 1-fluoro-2-methylbenze...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9)?

Proper safety measures are essential when handling 1-Fluoro-2-methyl-4-nitrobenzene. Always wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...