Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9)?

Answer

1-Fluoro-2-methyl-4-nitrobenzene
1-Fluoro-2-methyl-4-nitrobenzene is a crystalline solid with a molecular weight of approximately 184.04 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol, acetone, and chloroform. This compound is known for its reactivity, particularly in electrophilic aromatic substitution reactions.

About

CAS No 455-88-9
English Name 1-Fluoro-2-methyl-4-nitrobenzene
Molecular Formula C7H6FNO2
Molecular Weight 155.13 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey XUCYJGMIICONES-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9) typically synthesized?

1-Fluoro-2-methyl-4-nitrobenzene is commonly synthesized via the nitration of 1-fluoro-2-methylbenze...

Compound Q&A

What industries use 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9)?

1-Fluoro-2-methyl-4-nitrobenzene finds applications in the pharmaceutical industry, where it is used...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-methyl-4-nitrobenzene (CAS: 455-88-9)?

Proper safety measures are essential when handling 1-Fluoro-2-methyl-4-nitrobenzene. Always wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...