Compound Q&A

What industries use 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7)?

Answer

4-Methyl-3-nitrobenzonitrile
4-Methyl-3-nitrobenzonitrile finds applications in various industries. It is used in the synthesis of dyes and pigments, as an intermediate in the production of pharmaceuticals, and in the development of sensors and electronic materials. Additionally, it is utilized in the manufacturing of certain polymers and as a reagent in analytical chemistry.

About

CAS No 939-79-7
English Name 4-Methyl-3-nitrobenzonitrile
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES CC1=C(C=C(C=C1)C#N)[N+](=O)[O-]
InChIKey KOFBNBCOGKLUOM-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7)?

4-Methyl-3-nitrobenzonitrile is a white or light yellow crystalline solid with a molecular weight of...

Compound Q&A

How is 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7) typically synthesized?

4-Methyl-3-nitrobenzonitrile can be synthesized through the nitrilation of 4-methyl-3-nitrobenzoic a...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7)?

When handling 4-Methyl-3-nitrobenzonitrile, it is essential to follow safety guidelines. It should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...