Compound Q&A

How is 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7) typically synthesized?

Answer

4-Methyl-3-nitrobenzonitrile
4-Methyl-3-nitrobenzonitrile can be synthesized through the nitrilation of 4-methyl-3-nitrobenzoic acid or its derivatives. Common methods include the use of nitric acid in the presence of concentrated sulfuric acid as a catalyst, followed by hydrolysis of the imide intermediate. The reaction is typically carried out at elevated temperatures, and the yield can range from 70-85% depending on the reaction conditions.

About

CAS No 939-79-7
English Name 4-Methyl-3-nitrobenzonitrile
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES CC1=C(C=C(C=C1)C#N)[N+](=O)[O-]
InChIKey KOFBNBCOGKLUOM-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7)?

4-Methyl-3-nitrobenzonitrile is a white or light yellow crystalline solid with a molecular weight of...

Compound Q&A

What industries use 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7)?

4-Methyl-3-nitrobenzonitrile finds applications in various industries. It is used in the synthesis o...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-nitrobenzonitrile (CAS: 939-79-7)?

When handling 4-Methyl-3-nitrobenzonitrile, it is essential to follow safety guidelines. It should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...