Compound Q&A

What industries use 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7)?

Answer

2,2-Dimethyl-1,3-propanediyl bisacrylate
2,2-Dimethyl-1,3-propanediyl bisacrylate is widely used in various industries. It serves as a crosslinking agent in the production of adhesives, coatings, and inks. In the polymer industry, it is used to create flexible and resilient polymers. Additionally, it finds application in the pharmaceutical industry for the synthesis of certain polymers used in drug delivery systems. Its use in sensors and semiconductors is also growing due to its ability to form stable and strong bonds.

About

CAS No 2223-82-7
English Name 2,2-Dimethyl-1,3-propanediyl bisacrylate
Molecular Formula C11H16O4
Molecular Weight 212.24 g/mol
SMILES CC(C)(COC(=O)C=C)COC(=O)C=C
InChIKey MXFQRSUWYYSPOC-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7)?

2,2-Dimethyl-1,3-propanediyl bisacrylate is a colorless liquid with a molecular weight of approximat...

Compound Q&A

How is 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7) typically synthesized?

2,2-Dimethyl-1,3-propanediyl bisacrylate is synthesized via the reaction of 2,2-dimethyl-1,3-propane...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7)?

When handling 2,2-Dimethyl-1,3-propanediyl bisacrylate, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...