Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7)?

Answer

2,2-Dimethyl-1,3-propanediyl bisacrylate
2,2-Dimethyl-1,3-propanediyl bisacrylate is a colorless liquid with a molecular weight of approximately 164.24 g/mol. It has a boiling point of 137°C and a density of 0.99 g/cm³. This compound is soluble in common organic solvents such as ethanol, acetone, and toluene. It reacts readily with a variety of monomers and initiators to form polymers. Its reactivity makes it useful in various applications, including polymer synthesis and as a crosslinking agent.

About

CAS No 2223-82-7
English Name 2,2-Dimethyl-1,3-propanediyl bisacrylate
Molecular Formula C11H16O4
Molecular Weight 212.24 g/mol
SMILES CC(C)(COC(=O)C=C)COC(=O)C=C
InChIKey MXFQRSUWYYSPOC-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7) typically synthesized?

2,2-Dimethyl-1,3-propanediyl bisacrylate is synthesized via the reaction of 2,2-dimethyl-1,3-propane...

Compound Q&A

What industries use 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7)?

2,2-Dimethyl-1,3-propanediyl bisacrylate is widely used in various industries. It serves as a crossl...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-1,3-propanediyl bisacrylate (CAS: 2223-82-7)?

When handling 2,2-Dimethyl-1,3-propanediyl bisacrylate, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...