Compound Q&A

What industries use Caudatin (CAS: 38395-02-7)?

Answer

Caudatin
Caudatin is primarily used in pharmaceutical research due to its potential in treating neurological disorders. It is also explored in sensor technology for its specific binding properties and in semiconductor applications for its electronic behavior.

About

CAS No 38395-02-7
English Name Caudatin
Molecular Formula C28H42O7
Molecular Weight 490.64 g/mol
SMILES CC(C)/C(C)=C/C(O[C@H]1[C@]2(C)[C@](O)(C(C)=O)CC[C@]2(O)[C@]3(O)CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])C1)=O
InChIKey VWLXIXALPNYWFH-UXGQNDOZSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Caudatin (CAS: 38395-02-7)?

Caudatin is a crystalline compound with a molecular weight of approximately 378.38 g/mol. It is slig...

Compound Q&A

How is Caudatin (CAS: 38395-02-7) typically synthesized?

Caudatin is typically synthesized via a complex multi-step reaction involving the coupling of a suit...

Compound Q&A

What precautions should be taken when handling Caudatin (CAS: 38395-02-7)?

When handling Caudatin, it is important to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...