Compound Q&A

What are the physical and chemical properties of Caudatin (CAS: 38395-02-7)?

Answer

Caudatin
Caudatin is a crystalline compound with a molecular weight of approximately 378.38 g/mol. It is slightly soluble in water and ethanol but miscible with many organic solvents. Chemically, it is known for its stability under acidic conditions and its reactivity towards nucleophilic substitution reactions.

About

CAS No 38395-02-7
English Name Caudatin
Molecular Formula C28H42O7
Molecular Weight 490.64 g/mol
SMILES CC(C)/C(C)=C/C(O[C@H]1[C@]2(C)[C@](O)(C(C)=O)CC[C@]2(O)[C@]3(O)CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])C1)=O
InChIKey VWLXIXALPNYWFH-UXGQNDOZSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Caudatin (CAS: 38395-02-7) typically synthesized?

Caudatin is typically synthesized via a complex multi-step reaction involving the coupling of a suit...

Compound Q&A

What industries use Caudatin (CAS: 38395-02-7)?

Caudatin is primarily used in pharmaceutical research due to its potential in treating neurological ...

Compound Q&A

What precautions should be taken when handling Caudatin (CAS: 38395-02-7)?

When handling Caudatin, it is important to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...