Compound Q&A

How is 2-Chloro-5-nitrophenol (CAS: 619-10-3) typically synthesized?

Answer

2-Chloro-5-nitrophenol
2-Chloro-5-nitrophenol can be synthesized via the nitration of 2-chlorophenol. The nitration is usually carried out using concentrated nitric acid and sulfuric acid as the nitrating agent. The reaction is typically performed under reflux conditions, and the product is purified by recrystallization from a suitable solvent.

About

CAS No 619-10-3
English Name 2-Chloro-5-nitrophenol
Molecular Formula C6H4ClNO3
Molecular Weight 173.55 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])O)Cl
InChIKey BUMGQSCPTLELLS-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitrophenol (CAS: 619-10-3)?

2-Chloro-5-nitrophenol (CAS: 619-10-3) is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 2-Chloro-5-nitrophenol (CAS: 619-10-3)?

2-Chloro-5-nitrophenol (CAS: 619-10-3) is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitrophenol (CAS: 619-10-3)?

When handling 2-Chloro-5-nitrophenol (CAS: 619-10-3), it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...