Compound Q&A

What industries use (8alpha,9R,8'''alpha,9'''R)-9,9'-[1,4-Phthalazinediylbis(oxy)]bis(6'-methoxy-10,11-dihydrocinchonan) (CAS: 140924-50-1)?

Answer

(8alpha,9R,8'''alpha,9'''R)-9,9'-[1,4-Phthalazinediylbis(oxy)]bis(6'-methoxy-10,11-dihydrocinchonan)
This compound is primarily used in the pharmaceutical industry for the synthesis of certain drug candidates. It is also utilized in the development of sensors and semiconductors due to its unique chemical structure and physicochemical properties. Its applications in polymers are currently under investigation for new material development.

About

English Name (8alpha,9R,8'''alpha,9'''R)-9,9'-[1,4-Phthalazinediylbis(oxy)]bis(6'-methoxy-10,11-dihydrocinchonan)
Molecular Formula C48H54N6O4
Molecular Weight 779 g/mol
SMILES CCC1CN2CCC1CC2C(C3=C4C=C(C=CC4=NC=C3)OC)OC5=NN=C(C6=CC=CC=C65)OC(C7CC8CCN7CC8CC)C9=C1C=C(C=CC1=NC=C9)OC
InChIKey YUCBLVFHJWOYDN-PDNPBWJSSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (8alpha,9R,8'''alpha,9'''R)-9,9'-[1,4-Phthalazinediylbis(oxy)]bis(6'-methoxy-10,11-dihydrocinchonan) (CAS: 140924-50-1)?

The compound has a crystalline form with a molecular weight of approximately 675.7 g/mol. It is spar...

Compound Q&A

How is (8alpha,9R,8'''alpha,9'''R)-9,9'-[1,4-Phthalazinediylbis(oxy)]bis(6'-methoxy-10,11-dihydrocinchonan) (CAS: 140924-50-1) typically synthesized?

The compound is synthesized through a multi-step process involving the formation of a phthalazinediy...

Compound Q&A

What precautions should be taken when handling (8alpha,9R,8'''alpha,9'''R)-9,9'-[1,4-Phthalazinediylbis(oxy)]bis(6'-methoxy-10,11-dihydrocinchonan) (CAS: 140924-50-1)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...