Compound Q&A

What industries use (3,4-Dimethoxyphenyl)(phenyl)methanone (CAS: 4038-14-6)?

Answer

(3,4-Dimethoxyphenyl)(phenyl)methanone
(3,4-Dimethoxyphenyl)(phenyl)methanone is used in various industries, particularly in the pharmaceutical and polymer sectors. In the pharmaceutical industry, it serves as a key intermediate in the synthesis of certain drugs. In polymer manufacturing, it can be used as a monomer or additive to enhance properties like flexibility and thermal stability. Additionally, it has applications in the production of sensors and semiconductors given its electronic properties.

About

CAS No 4038-14-6
English Name (3,4-Dimethoxyphenyl)(phenyl)methanone
Molecular Formula C15H14O3
Molecular Weight 242.27 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)OC
InChIKey WCNOATOQNSHEFK-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,4-Dimethoxyphenyl)(phenyl)methanone (CAS: 4038-14-6)?

(3,4-Dimethoxyphenyl)(phenyl)methanone is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is (3,4-Dimethoxyphenyl)(phenyl)methanone (CAS: 4038-14-6) typically synthesized?

(3,4-Dimethoxyphenyl)(phenyl)methanone can be synthesized through a condensation reaction between 3,...

Compound Q&A

What precautions should be taken when handling (3,4-Dimethoxyphenyl)(phenyl)methanone (CAS: 4038-14-6)?

When handling (3,4-Dimethoxyphenyl)(phenyl)methanone, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...