Compound Q&A

How should [(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7) be stored?

Answer

[(Tribromomethyl)sulfonyl]benzene
[(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Ideal storage conditions are below 25°C and with minimal exposure to air to maintain stability.

About

CAS No 17025-47-7
English Name [(Tribromomethyl)sulfonyl]benzene
Molecular Formula C7H5Br3O2S
Molecular Weight 392.894 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)C(Br)(Br)Br
InChIKey DWWMSEANWMWMCB-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is [(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7)?

[(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7) is a complex organic compound featuring a benzen...

Compound Q&A

What are the main uses of [(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7)?

[(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7) is mainly used in academic and industrial resear...

Compound Q&A

Is [(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7) safe?

[(Tribromomethyl)sulfonyl]benzene (CAS: 17025-47-7) should be handled with caution due to its reacti...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...