Compound Q&A

What are the main uses of (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6)?

Answer

(3,5-Dichlorophenyl)boronic acid
(3,5-Dichlorophenyl)boronic acid is widely used in pharmaceuticals as a precursor in the synthesis of various drugs. It also serves as a reagent in polymer chemistry, organic synthesis, and molecular biology, particularly in bioassays and in vitro diagnostics. Its boronic acid functionality allows it to participate in boronate ester formation, which is utilized in organic transformations.

About

CAS No 67492-50-6
English Name (3,5-Dichlorophenyl)boronic acid
Molecular Formula C6H5BCl2O2
Molecular Weight 190.822 g/mol
SMILES B(C1=CC(=CC(=C1)Cl)Cl)(O)O
InChIKey DKYRKAIKWFHQHM-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6)?

(3,5-Dichlorophenyl)boronic acid, also known as 3,5-dichlorophenylboronic acid, is a chemical compou...

Compound Q&A

Is (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6) safe?

(3,5-Dichlorophenyl)boronic acid is generally considered safe when handled with appropriate precauti...

Compound Q&A

How should (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6) be stored?

(3,5-Dichlorophenyl)boronic acid should be stored in a cool, dry place, away from direct sunlight an...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...