Compound Q&A

What is (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6)?

Answer

(3,5-Dichlorophenyl)boronic acid
(3,5-Dichlorophenyl)boronic acid, also known as 3,5-dichlorophenylboronic acid, is a chemical compound with the CAS number 67492-50-6. It is a white or off-white crystalline solid with a molecular formula of C8H4Cl2BO3. It is a boronic acid derivative and is used in various applications including pharmaceuticals, organic synthesis, and as a reagent in molecular biology.

About

CAS No 67492-50-6
English Name (3,5-Dichlorophenyl)boronic acid
Molecular Formula C6H5BCl2O2
Molecular Weight 190.822 g/mol
SMILES B(C1=CC(=CC(=C1)Cl)Cl)(O)O
InChIKey DKYRKAIKWFHQHM-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6)?

(3,5-Dichlorophenyl)boronic acid is widely used in pharmaceuticals as a precursor in the synthesis o...

Compound Q&A

Is (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6) safe?

(3,5-Dichlorophenyl)boronic acid is generally considered safe when handled with appropriate precauti...

Compound Q&A

How should (3,5-Dichlorophenyl)boronic acid (CAS: 67492-50-6) be stored?

(3,5-Dichlorophenyl)boronic acid should be stored in a cool, dry place, away from direct sunlight an...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...