Compound Q&A

Is Isonicotinic acid 1-oxide (CAS: 13602-12-5) safe?

Answer

Isonicotinic acid 1-oxide
Isonicotinic acid 1-oxide is considered safe when handled with proper precautions. However, it should be stored in a well-ventilated area away from heat and sources of ignition. Protective equipment such as gloves and goggles should be worn to prevent skin and eye contact.

About

CAS No 13602-12-5
English Name Isonicotinic acid 1-oxide
Molecular Formula C6H5NO3
Molecular Weight 139.11 g/mol
SMILES C1=C[N+](=CC=C1C(=O)O)[O-]
InChIKey QCWTWMJMLSKQCJ-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is Isonicotinic acid 1-oxide (CAS: 13602-12-5)?

Isonicotinic acid 1-oxide, also known as nicotinoyl hydrazine, is a chemical compound with the CAS n...

Compound Q&A

What are the main uses of Isonicotinic acid 1-oxide (CAS: 13602-12-5)?

Isonicotinic acid 1-oxide is primarily used in the synthesis of drugs, particularly antitubercular a...

Compound Q&A

How should Isonicotinic acid 1-oxide (CAS: 13602-12-5) be stored?

Isonicotinic acid 1-oxide should be stored in a cool, dry place away from direct sunlight and source...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...