Compound Q&A

What are the main uses of Isonicotinic acid 1-oxide (CAS: 13602-12-5)?

Answer

Isonicotinic acid 1-oxide
Isonicotinic acid 1-oxide is primarily used in the synthesis of drugs, particularly antitubercular agents, and in research for developing new pharmaceuticals. It is also utilized in organic synthesis for the preparation of other compounds.

About

CAS No 13602-12-5
English Name Isonicotinic acid 1-oxide
Molecular Formula C6H5NO3
Molecular Weight 139.11 g/mol
SMILES C1=C[N+](=CC=C1C(=O)O)[O-]
InChIKey QCWTWMJMLSKQCJ-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is Isonicotinic acid 1-oxide (CAS: 13602-12-5)?

Isonicotinic acid 1-oxide, also known as nicotinoyl hydrazine, is a chemical compound with the CAS n...

Compound Q&A

Is Isonicotinic acid 1-oxide (CAS: 13602-12-5) safe?

Isonicotinic acid 1-oxide is considered safe when handled with proper precautions. However, it shoul...

Compound Q&A

How should Isonicotinic acid 1-oxide (CAS: 13602-12-5) be stored?

Isonicotinic acid 1-oxide should be stored in a cool, dry place away from direct sunlight and source...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...