Compound Q&A

What is landiolol hydrochloride (CAS: 144481-98-1)?

Answer

Landiolol hydrochloride
Landinolol hydrochloride is a selective beta1-adrenergic receptor antagonist used in the treatment of arrhythmias and hypertension. It has a molecular formula of C18H30ClN2O2S and a molecular weight of 377.86. This compound is known for its cardiovascular benefits and is often used in clinical settings due to its specific pharmacological profile.

About

English Name Landiolol hydrochloride
Molecular Formula C25H40ClN3O8
Molecular Weight 546.1 g/mol
SMILES CC1(OCC(O1)COC(=O)CCC2=CC=C(C=C2)OCC(CNCCNC(=O)N3CCOCC3)O)C.Cl
InChIKey DLPGJHSONYLBKP-IKGOIYPNSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of landiolol hydrochloride (CAS: 144481-98-1)?

Landinolol hydrochloride is primarily used in the management of various cardiac conditions, includin...

Compound Q&A

Is landiolol hydrochloride (CAS: 144481-98-1) safe?

Landinolol hydrochloride is generally safe when used under medical supervision. However, it is impor...

Compound Q&A

How should landiolol hydrochloride (CAS: 144481-98-1) be stored?

Landinolol hydrochloride should be stored at a temperature not exceeding 25°C (77°F). Keep the compo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...