Compound Q&A

What industries use 1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7)?

Answer

1,3-Bis(trimethylsilyl)urea
1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7) is primarily used in the pharmaceuticals and organic synthesis industries. It serves as a protecting group in synthetic chemistry, particularly in the modification of amine functionalities. It is also used in the production of semiconductors and some polymer applications due to its ability to control reactivity and molecular structure.

About

CAS No 18297-63-7
English Name 1,3-Bis(trimethylsilyl)urea
Molecular Formula C7H20N2OSi2
Molecular Weight 204.42 g/mol
SMILES C[Si](C)(C)NC(=O)N[Si](C)(C)C
InChIKey MASDFXZJIDNRTR-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7)?

1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7) is a colorless crystalline solid with a molecular weig...

Compound Q&A

How is 1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7) typically synthesized?

1,3-Bis(trimethylsilyl)urea is typically synthesized via the reaction of isocyanuric acid with trime...

Compound Q&A

What precautions should be taken when handling 1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7)?

When handling 1,3-Bis(trimethylsilyl)urea (CAS: 18297-63-7), it is important to use proper personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...