Compound Q&A

What precautions should be taken when handling 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4)?

Answer

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (1:1)
When handling 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. Work should be conducted in a fume hood to minimize exposure. In case of a spill, immediately clean up using appropriate absorption materials and dispose of waste according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 52853-40-4
English Name 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (1:1)
Molecular Formula C7H8Br2N6
Molecular Weight 335.99 g/mol
SMILES C1=C(N=C2C(=NC(=NC2=N1)N)N)CBr.Br
InChIKey KMQIBGKVZDBGAH-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4)?

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4) is a crystalline compound with a...

Compound Q&A

How is 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4) typically synthesized?

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide is typically synthesized through a multi-step proc...

Compound Q&A

What industries use 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4)?

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4) is used in various industries, p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...