Compound Q&A

How is 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4) typically synthesized?

Answer

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (1:1)
6-(Bromomethyl)-2,4-pteridinediamine hydrobromide is typically synthesized through a multi-step process involving the bromination of a 2,4-pteridinediamine followed by the addition of a bromomethyl group. The synthesis involves the use of bromine and a suitable bromination agent, with careful control of reaction conditions to achieve high yield and selectivity. Commonly used solvents include dichloromethane and acetonitrile.

About

CAS No 52853-40-4
English Name 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (1:1)
Molecular Formula C7H8Br2N6
Molecular Weight 335.99 g/mol
SMILES C1=C(N=C2C(=NC(=NC2=N1)N)N)CBr.Br
InChIKey KMQIBGKVZDBGAH-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4)?

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4) is a crystalline compound with a...

Compound Q&A

What industries use 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4)?

6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4) is used in various industries, p...

Compound Q&A

What precautions should be taken when handling 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4)?

When handling 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide (CAS: 52853-40-4), it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...