Compound Q&A

What industries use N,N,N-Trimethylanilinium chloride (CAS: 138-24-9)?

Answer

N,N,N-Trimethylanilinium chloride
N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) is primarily used in the pharmaceutical industry, where it serves as an intermediate in the synthesis of various drugs. It also finds applications in the polymer industry for modifying material properties, in sensors for detecting specific chemicals, and in the semiconductor industry as a reagent.

About

CAS No 138-24-9
English Name N,N,N-Trimethylanilinium chloride
Molecular Formula C9H14ClN
Molecular Weight 171.67 g/mol
SMILES C[N+](C)(C)C1=CC=CC=C1.[Cl-]
InChIKey MQAYPFVXSPHGJM-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylanilinium chloride (CAS: 138-24-9)?

N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) is a crystalline solid with a molecular weight of ...

Compound Q&A

How is N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) typically synthesized?

N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) is synthesized by reacting 2-methylaniline with hy...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylanilinium chloride (CAS: 138-24-9)?

When handling N,N,N-Trimethylanilinium chloride (CAS: 138-24-9), use personal protective equipment s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...