Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylanilinium chloride (CAS: 138-24-9)?

Answer

N,N,N-Trimethylanilinium chloride
N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) is a crystalline solid with a molecular weight of approximately 176.2. It has a high solubility in water and organic solvents. Chemically, it is stable but can react with strong acids. It is used as a precursor in organic synthesis and pharmaceuticals.

About

CAS No 138-24-9
English Name N,N,N-Trimethylanilinium chloride
Molecular Formula C9H14ClN
Molecular Weight 171.67 g/mol
SMILES C[N+](C)(C)C1=CC=CC=C1.[Cl-]
InChIKey MQAYPFVXSPHGJM-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) typically synthesized?

N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) is synthesized by reacting 2-methylaniline with hy...

Compound Q&A

What industries use N,N,N-Trimethylanilinium chloride (CAS: 138-24-9)?

N,N,N-Trimethylanilinium chloride (CAS: 138-24-9) is primarily used in the pharmaceutical industry, ...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylanilinium chloride (CAS: 138-24-9)?

When handling N,N,N-Trimethylanilinium chloride (CAS: 138-24-9), use personal protective equipment s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...