Compound Q&A

What industries use 5'-Guanylic acid (CAS: 85-32-5)?

Answer

5'-Guanylic acid
5'-Guanylic acid (CAS: 85-32-5) is primarily used in the pharmaceutical industry for the production of nucleoside analogs and nucleotide drugs. It also finds applications in biochemical research and the development of sensors and semiconductors due to its nucleotide structure.

About

CAS No 85-32-5
English Name 5'-Guanylic acid
Molecular Formula C10H14N5O8P
Molecular Weight 363.22 g/mol
SMILES O=P(O)(OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(N)NC3=O)O1)O)O)O
InChIKey RQFCJASXJCIDSX-UUOKFMHZSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What precautions should be taken when handling 5'-Guanylic acid (CAS: 85-32-5)?

When handling 5'-Guanylic acid (CAS: 85-32-5), it is essential to wear appropriate personal protecti...

Compound Q&A

What are the physical and chemical properties of 5'-Guanylic acid (CAS: 85-32-5)?

5'-Guanylic acid (CAS: 85-32-5) is a white crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 5'-Guanylic acid (CAS: 85-32-5) typically synthesized?

5'-Guanylic acid (CAS: 85-32-5) is synthesized through the condensation of guanine with 5'-phosphori...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...