Compound Q&A

How is Jatrorrhizine Chloride (CAS: 6681-15-8) typically synthesized?

Answer

Jatrorrhizine Chloride
Jatrorrhizine Chloride (CAS: 6681-15-8) is synthesized through a multi-step process involving the extraction of the natural compound jatrorrhizine from the root of the plant Cyperus rotundus and subsequent chlorination. Commonly, this involves treating jatrorrhizine with chlorine gas or hydrochloric acid under controlled conditions to achieve high yield and selectivity.

About

CAS No 6681-15-8
English Name Jatrorrhizine Chloride
Molecular Formula C20H20ClNO4
Molecular Weight 373.8 g/mol
SMILES COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC.[Cl-]
InChIKey JKMUUZMCSNHBAX-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Jatrorrhizine Chloride (CAS: 6681-15-8)?

Jatrorrhizine Chloride (CAS: 6681-15-8) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use Jatrorrhizine Chloride (CAS: 6681-15-8)?

Jatrorrhizine Chloride (CAS: 6681-15-8) is primarily used in the pharmaceutical industry for its ant...

Compound Q&A

What precautions should be taken when handling Jatrorrhizine Chloride (CAS: 6681-15-8)?

When handling Jatrorrhizine Chloride (CAS: 6681-15-8), it is essential to wear personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...