Compound Q&A

What are the physical and chemical properties of Jatrorrhizine Chloride (CAS: 6681-15-8)?

Answer

Jatrorrhizine Chloride
Jatrorrhizine Chloride (CAS: 6681-15-8) is a crystalline compound with a molecular weight of approximately 302.7 g/mol. It is slightly soluble in water and ethanol. Chemically, it exhibits basic properties due to the chloride group and can react with strong acids to regenerate the free base form. It is stable under normal conditions but should be stored in a dry place to prevent hydrolysis.

About

CAS No 6681-15-8
English Name Jatrorrhizine Chloride
Molecular Formula C20H20ClNO4
Molecular Weight 373.8 g/mol
SMILES COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC.[Cl-]
InChIKey JKMUUZMCSNHBAX-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Jatrorrhizine Chloride (CAS: 6681-15-8) typically synthesized?

Jatrorrhizine Chloride (CAS: 6681-15-8) is synthesized through a multi-step process involving the ex...

Compound Q&A

What industries use Jatrorrhizine Chloride (CAS: 6681-15-8)?

Jatrorrhizine Chloride (CAS: 6681-15-8) is primarily used in the pharmaceutical industry for its ant...

Compound Q&A

What precautions should be taken when handling Jatrorrhizine Chloride (CAS: 6681-15-8)?

When handling Jatrorrhizine Chloride (CAS: 6681-15-8), it is essential to wear personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...