Compound Q&A

What industries use Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6)?

Answer

Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate
Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) is primarily used in the pharmaceutical industry due to its potential as a drug candidate. It is also of interest in the polymer industry for its antioxidant properties and in the development of sensors and semiconductors for its unique electronic behavior.

About

English Name Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate
Molecular Formula C15H14NNaO3S2
Molecular Weight 343.4 g/mol
SMILES C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CCCS(=O)(=O)[O-].[Na+]
InChIKey VKGYKXFNSKEHED-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6)?

Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) is a white crystalline solid...

Compound Q&A

How is Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) typically synthesized?

Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) is synthesized through a mul...

Compound Q&A

What precautions should be taken when handling Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6)?

When handling Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...