Compound Q&A

What are the physical and chemical properties of Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6)?

Answer

Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate
Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) is a white crystalline solid with a molecular weight of approximately 268.26 g/mol. It is slightly soluble in water and alcohol. This compound is known for its stability in acidic and basic conditions and has limited reactivity with common reagents. It is often used in pharmaceutical applications due to its unique chemical structure.

About

English Name Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate
Molecular Formula C15H14NNaO3S2
Molecular Weight 343.4 g/mol
SMILES C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CCCS(=O)(=O)[O-].[Na+]
InChIKey VKGYKXFNSKEHED-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) typically synthesized?

Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) is synthesized through a mul...

Compound Q&A

What industries use Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6)?

Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6) is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6)?

When handling Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate (CAS: 101199-38-6), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...