Compound Q&A

What industries use 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2)?

Answer

2,3,6,7,10,11-Hexabromotriphenylene
2,3,6,7,10,11-Hexabromotriphenylene finds applications in the polymer industry as a flame retardant, in the pharmaceutical sector for its potential as an anti-inflammatory agent, and in the semiconductor industry due to its electronic properties. It also has potential uses in sensors and as a photostabilizer.

About

CAS No 82632-80-2
English Name 2,3,6,7,10,11-Hexabromotriphenylene
Molecular Formula C18H6Br6
Molecular Weight 701.67 g/mol
SMILES BrC1=C(Br)C=C2C3=CC(Br)=C(Br)C=C3C4=CC(Br)=C(Br)C=C4C2=C1
InChIKey GLHQUXLCQLQNPZ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2)?

2,3,6,7,10,11-Hexabromotriphenylene is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2) typically synthesized?

2,3,6,7,10,11-Hexabromotriphenylene is usually synthesized via bromination of triphenylene using a c...

Compound Q&A

What precautions should be taken when handling 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2)?

When handling 2,3,6,7,10,11-Hexabromotriphenylene, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...