Compound Q&A

What are the physical and chemical properties of 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2)?

Answer

2,3,6,7,10,11-Hexabromotriphenylene
2,3,6,7,10,11-Hexabromotriphenylene is a crystalline compound with a molecular weight of approximately 694.68 g/mol. It has low water solubility but is soluble in organic solvents like benzene and chloroform. The compound is relatively stable but can undergo photolysis. It is less reactive compared to other brominated compounds.

About

CAS No 82632-80-2
English Name 2,3,6,7,10,11-Hexabromotriphenylene
Molecular Formula C18H6Br6
Molecular Weight 701.67 g/mol
SMILES BrC1=C(Br)C=C2C3=CC(Br)=C(Br)C=C3C4=CC(Br)=C(Br)C=C4C2=C1
InChIKey GLHQUXLCQLQNPZ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2) typically synthesized?

2,3,6,7,10,11-Hexabromotriphenylene is usually synthesized via bromination of triphenylene using a c...

Compound Q&A

What industries use 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2)?

2,3,6,7,10,11-Hexabromotriphenylene finds applications in the polymer industry as a flame retardant,...

Compound Q&A

What precautions should be taken when handling 2,3,6,7,10,11-Hexabromotriphenylene (CAS: 82632-80-2)?

When handling 2,3,6,7,10,11-Hexabromotriphenylene, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...