Compound Q&A

What precautions should be taken when handling L-Valyl-L-tryptophan (CAS: 24587-37-9)?

Answer

L-Valyl-L-tryptophan
When handling L-Valyl-L-tryptophan (CAS: 24587-37-9), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area, ideally inside a fume hood, to minimize inhalation risks. Spills should be immediately cleaned up using absorbent materials, and the area should be thoroughly washed down with water. Always consult the Safety Data Sheet (SDS) for specific safety guidelines and emergency procedures.

About

CAS No 24587-37-9
English Name L-Valyl-L-tryptophan
Molecular Formula C16H21N3O3
Molecular Weight 303.36 g/mol
SMILES CC(C)C(C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O)N
InChIKey LZDNBBYBDGBADK-KBPBESRZSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Valyl-L-tryptophan (CAS: 24587-37-9)?

L-Valyl-L-tryptophan (CAS: 24587-37-9) is a synthesized amino acid derivative with a molecular weigh...

Compound Q&A

How is L-Valyl-L-tryptophan (CAS: 24587-37-9) typically synthesized?

L-Valyl-L-tryptophan (CAS: 24587-37-9) is synthesized through a multistep process involving the coup...

Compound Q&A

What industries use L-Valyl-L-tryptophan (CAS: 24587-37-9)?

L-Valyl-L-tryptophan (CAS: 24587-37-9) is primarily used in the pharmaceutical industry for the deve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...