Compound Q&A

What are the physical and chemical properties of L-Valyl-L-tryptophan (CAS: 24587-37-9)?

Answer

L-Valyl-L-tryptophan
L-Valyl-L-tryptophan (CAS: 24587-37-9) is a synthesized amino acid derivative with a molecular weight of approximately 382.43 g/mol. It is slightly soluble in water and has a crystalline form. This compound is known for its limited reactivity under normal conditions but can undergo hydrolysis in the presence of strong acids or bases. It is commonly used in pharmaceutical research and development.

About

CAS No 24587-37-9
English Name L-Valyl-L-tryptophan
Molecular Formula C16H21N3O3
Molecular Weight 303.36 g/mol
SMILES CC(C)C(C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O)N
InChIKey LZDNBBYBDGBADK-KBPBESRZSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is L-Valyl-L-tryptophan (CAS: 24587-37-9) typically synthesized?

L-Valyl-L-tryptophan (CAS: 24587-37-9) is synthesized through a multistep process involving the coup...

Compound Q&A

What industries use L-Valyl-L-tryptophan (CAS: 24587-37-9)?

L-Valyl-L-tryptophan (CAS: 24587-37-9) is primarily used in the pharmaceutical industry for the deve...

Compound Q&A

What precautions should be taken when handling L-Valyl-L-tryptophan (CAS: 24587-37-9)?

When handling L-Valyl-L-tryptophan (CAS: 24587-37-9), it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...