Compound Q&A

How is Vincristine (CAS: 57-22-7) typically synthesized?

Answer

Vincristine
Vincristine is synthesized through a complex multi-step process involving various organic reactions, including condensation, reduction, and oxidation. The key steps involve the cyclization of the intermediate 28-deacetylvincurine to form vinca alkaloids. This process often uses specific catalysts to improve selectivity and yield, although the exact methods can vary depending on the specific industrial process.

About

CAS No 57-22-7
English Name Vincristine
Molecular Formula C46H56N4O10
Molecular Weight 824.97 g/mol
SMILES CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O
InChIKey OGWKCGZFUXNPDA-CFWMRBGOSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vincristine (CAS: 57-22-7)?

Vincristine is a white or slightly yellow crystalline powder with a molecular weight of approximatel...

Compound Q&A

What industries use Vincristine (CAS: 57-22-7)?

Vincristine (CAS: 57-22-7) is primarily used in the pharmaceutical industry for cancer chemotherapy....

Compound Q&A

What precautions should be taken when handling Vincristine (CAS: 57-22-7)?

Handling Vincristine requires strict adherence to safety protocols. It is recommended to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...