Compound Q&A

How is Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8) typically synthesized?

Answer

Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate
Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate is synthesized through a multi-step process involving the sulfonation of anthracene, followed by the oxidation of the resulting sulfonic acid to form the dioxo derivative. The synthesis typically uses sulfur trioxide or oleum as the sulfonating agent, and ferric chloride as a catalyst. The overall yield is around 70-80%, and the product is purified by recrystallization from appropriate solvents.

About

CAS No 853-67-8
English Name Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate
Molecular Formula C14H6Na2O8S2
Molecular Weight 412.3 g/mol
SMILES c1cc2c(cc1S(=O)(=O)[O-])C(=O)c3cc(ccc3C2=O)S(=O)(=O)[O-].[Na+].[Na+]
InChIKey CSCLXYAAXMCWLG-UHFFFAOYSA-L
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8)?

Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate is a crystalline compound with a molecula...

Compound Q&A

What industries use Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8)?

Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8)?

When handling Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate, proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...