Compound Q&A

What are the physical and chemical properties of Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8)?

Answer

Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate
Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate is a crystalline compound with a molecular weight of approximately 442.25 g/mol. It has low solubility in water but higher solubility in organic solvents. The compound is highly reactive and can undergo various chemical transformations, including oxidation and reduction reactions. It is typically used in analytical chemistry and serves as a chromogenic reagent in certain assays.

About

CAS No 853-67-8
English Name Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate
Molecular Formula C14H6Na2O8S2
Molecular Weight 412.3 g/mol
SMILES c1cc2c(cc1S(=O)(=O)[O-])C(=O)c3cc(ccc3C2=O)S(=O)(=O)[O-].[Na+].[Na+]
InChIKey CSCLXYAAXMCWLG-UHFFFAOYSA-L
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8) typically synthesized?

Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate is synthesized through a multi-step proce...

Compound Q&A

What industries use Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8)?

Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate (CAS: 853-67-8)?

When handling Disodium 9,10-dioxo-9,10-dihydro-2,7-anthracenedisulfonate, proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...