Compound Q&A

What industries use Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8)?

Answer

Benzyl (4-bromo-3-fluorophenyl)carbamate
Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8) is primarily used in the pharmaceutical industry for the synthesis of various drug intermediates. It also finds applications in the polymer industry for the production of specialized polymers. Additionally, it is used in the development of sensors and semiconductors due to its unique chemical properties and reactivity.

About

English Name Benzyl (4-bromo-3-fluorophenyl)carbamate
Molecular Formula C14H11BrFNO2
Molecular Weight 324.15 g/mol
SMILES C1=CC=C(C=C1)COC(=O)NC2=CC(=C(C=C2)Br)F
InChIKey UPTMRBYILBFUPA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8)?

Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8) is a white crystalline solid. Its molecu...

Compound Q&A

How is Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8) typically synthesized?

Benzyl (4-bromo-3-fluorophenyl)carbamate is typically synthesized through a multi-step process invol...

Compound Q&A

What precautions should be taken when handling Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8)?

When handling Benzyl (4-bromo-3-fluorophenyl)carbamate (CAS: 510729-01-8), it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...