Compound Q&A

What are the physical and chemical properties of 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione (CAS: 7300-91-6)?

Answer

1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione
1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione is a crystalline solid with a molecular weight of approximately 208.15 g/mol. It has a solubility of about 1.4 g/L in water, and its melting point is around 168-169°C. The compound is known for its acidic nature due to the presence of the hydroxy group, which can participate in hydrogen bonding. Chemically, it is relatively stable but can undergo ring-opening reactions under basic conditions.

About

CAS No 7300-91-6
English Name 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1N2C(=O)C=CC2=O)O
InChIKey BLLFPKZTBLMEFG-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione (CAS: 7300-91-6) typically synthesized?

1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione can be synthesized by the condensation reaction of 4-hydrox...

Compound Q&A

What industries use 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione (CAS: 7300-91-6)?

1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione finds applications in various industries. It is used in the...

Compound Q&A

What precautions should be taken when handling 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione (CAS: 7300-91-6)?

When handling 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...