Compound Q&A

What industries use Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

Answer

Dibenzo[b,d]thiophene 5,5-dioxide
Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) is used in various industries. It is a key intermediate in the production of pharmaceuticals, where it plays a role in the synthesis of bioactive compounds. Additionally, it is used in polymer chemistry, where it enhances the performance of certain materials. Its applications also extend to sensors and semiconductors due to its unique electronic properties.

About

CAS No 1016-05-3
English Name Dibenzo[b,d]thiophene 5,5-dioxide
Molecular Formula C12H8O2S
Molecular Weight 216.26099999999997 g/mol
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3S2(=O)=O
InChIKey IKJFYINYNJYDTA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) is a crystalline solid with a molecular weight of...

Compound Q&A

How is Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) typically synthesized?

Dibenzo[b,d]thiophene 5,5-dioxide is typically synthesized through the oxidation of dibenzo[b,d]thio...

Compound Q&A

What precautions should be taken when handling Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

When handling Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3), it is essential to use appropriate...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...