Compound Q&A

What are the physical and chemical properties of Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

Answer

Dibenzo[b,d]thiophene 5,5-dioxide
Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) is a crystalline solid with a molecular weight of approximately 242.27 g/mol. It is poorly soluble in water but soluble in common organic solvents such as ethanol and dichloromethane. The compound is less reactive compared to other thiophene derivatives but exhibits notable stability under normal storage conditions. It is a key intermediate in organic synthesis and pharmaceuticals.

About

CAS No 1016-05-3
English Name Dibenzo[b,d]thiophene 5,5-dioxide
Molecular Formula C12H8O2S
Molecular Weight 216.26099999999997 g/mol
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3S2(=O)=O
InChIKey IKJFYINYNJYDTA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) typically synthesized?

Dibenzo[b,d]thiophene 5,5-dioxide is typically synthesized through the oxidation of dibenzo[b,d]thio...

Compound Q&A

What industries use Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) is used in various industries. It is a key interm...

Compound Q&A

What precautions should be taken when handling Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

When handling Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3), it is essential to use appropriate...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...