Compound Q&A

How is Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) typically synthesized?

Answer

Dibenzo[b,d]thiophene 5,5-dioxide
Dibenzo[b,d]thiophene 5,5-dioxide is typically synthesized through the oxidation of dibenzo[b,d]thiophene using appropriate oxidizing agents such as potassium permanganate or sodium hypochlorite in the presence of a suitable solvent. The process yields the target compound with good selectivity and yield, making it a robust method for industrial production.

About

CAS No 1016-05-3
English Name Dibenzo[b,d]thiophene 5,5-dioxide
Molecular Formula C12H8O2S
Molecular Weight 216.26099999999997 g/mol
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3S2(=O)=O
InChIKey IKJFYINYNJYDTA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3) is used in various industries. It is a key interm...

Compound Q&A

What precautions should be taken when handling Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3)?

When handling Dibenzo[b,d]thiophene 5,5-dioxide (CAS: 1016-05-3), it is essential to use appropriate...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...